Scopine HCl
Scopine HCl salt is a naturally occuring α1-adrenergic receptor agonist and used in the treatment of acute circulatory shock and also s a potential brain-targeting moiety for enhancing the brain uptake efficiency of chlorambucil.
| Trivial name | Scopanol HCl |
| Catalog Number | CSN13046 |
| Alternative Name(s) | Scopanol HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C8H14ClNO2 |
| CAS# | 85700-55-6 |
| Purity | ≥98% |
| SMILES | O[C@H]1C[C@@]2([H])[C@]3([H])O[C@]3([H])[C@@](N2C)([H])C1.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/scopine-hcl.html |
