Cetirizine 2HCl
Cetirizine 2HCl, a metabolite of hydroxyzine, is racemic selective and inverse agonist of H1 receptor used in the treatment of allergies and hay fever.
| Trivial name | UCB P071; P-071 |
| Catalog Number | CSN12995 |
| Alternative Name(s) | UCB P071; P-071 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C21H27Cl3N2O3 |
| CAS# | 83881-52-1 |
| Purity | ≥99% |
| SMILES | O=C(COCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=C(Cl)C=C3)O.[H]Cl.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cetirizine-2hcl.html |