Quinapril HCl
Quinapril HCl is a prodrug-form ACE inhibitor with a Ki of 20 μM, usd for treatment for hypertension and congestive heart failure.
| Trivial name | CI-906; PD-109452-2 |
| Catalog Number | CSN12981 |
| Alternative Name(s) | CI-906; PD-109452-2 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C25H31ClN2O5 |
| CAS# | 82586-55-8 |
| Purity | ≥99% |
| SMILES | O=C([C@H]1N(C([C@@H](N[C@H](C(OCC)=O)CCC2=CC=CC=C2)C)=O)CC3=C(C=CC=C3)C1)O.Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/quinapril-hcl.html |
