Sitaxsentan Sodium
Sitaxsentan sodium has selectory antagonism of endothelin A (ETA) receptor with the IC50 and Ki value of 1.4 nM and 0.43 nM respectively.
| Trivial name | TBC11251 Sodium Salt |
| Catalog Number | CSN12974 |
| Alternative Name(s) | TBC11251 Sodium Salt |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C18H14ClN2NaO6S2 |
| CAS# | 210421-74-2 |
| Purity | ≥99% |
| SMILES | O=S([N-]C1=C(Cl)C(C)=NO1)(C2=C(C(CC3=C(C)C=C(OCO4)C4=C3)=O)SC=C2)=O.[Na+] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/sitaxsentan-sodium.html |