Marimastat
Marimastat is a competitive and broad-spectrum MMP inhibitor with IC50 values of 3, 5, 6, 9 and 13 nM for MMP-9, MMP-1, MMP-2, MMP-14 and MMP-7, respectively.
| Trivial name | BB-2516; TA-2516 |
| Catalog Number | CSN12943 |
| Alternative Name(s) | BB-2516; TA-2516 |
| Research Area | Cancer |
| Molecular Formula | C15H29N3O5 |
| CAS# | 154039-60-8 |
| Purity | ≥98% |
| SMILES | O=C(N[C@@H](C(C)(C)C)C(NC)=O)[C@H](CC(C)C)[C@H](O)C(NO)=O |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/marimastat.html |
