Amfenac Sodium Monohydrate
Amfenac Sodium Monohydrate is a non-steroidal analgesic anti-inflammatory drug with acetic acid moiety. The IC50 values for COX1 and COX2 is 250 nM and 150 nM, respectively.
| Trivial name | / |
| Catalog Number | CSN12868 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C15H14NNaO4 |
| CAS# | 61618-27-7 |
| Purity | ≥98% |
| SMILES | O=C([O-])CC1=CC=CC(C(C2=CC=CC=C2)=O)=C1N.[H]O[H].[Na+] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/amfenac-sodium-monohydrate.html |
