6-Mercaptopurine Monohydrate
6-Mercaptopurine Monohydrate inhibits the de novo purine synthesis through incorporation of thiopurine methyltransferase metabolites into DNA and RNA, it is a widely used antileukemic agent and immunosuppressive drug. 6-mercaptopurine was found to inhibit SARS-CoV PLpro.
| Trivial name | 6-MP Monohydrate; 6-Mercaptopurine Hydrate; 6-MP Hydrate |
| Catalog Number | CSN12836 |
| Alternative Name(s) | 6-MP Monohydrate; 6-Mercaptopurine Hydrate; 6-MP Hydrate |
| Research Area | / |
| Molecular Formula | C5H6N4OS |
| CAS# | 6112-76-1 |
| Purity | ≥99% |
| SMILES | SC1=C2NC=NC2=NC=N1.[H]O[H] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/6-mercaptopurine-monohydrate.html |