Xylose
Xylose, a natural product, can be catalyzed into xylulose by xylose isomerase, and it is the key step for anaerobic ethanolic fermentation of xylose. Can be used as an excipient in cosmetics and pharmaceuticals.
| Trivial name | D-(+)-Xylose; (+)-Xylose; Wood Sugar |
| Catalog Number | CSN12814 |
| Alternative Name(s) | D-(+)-Xylose; (+)-Xylose; Wood Sugar |
| Research Area | / |
| Molecular Formula | C5H10O5 |
| CAS# | 58-86-6 |
| Purity | ≥99% |
| SMILES | O=C[C@@H]([C@H]([C@@H](CO)O)O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/xylose.html |