Pyrimethamine
Pyrimethamine inhibits multidrug and toxin extrusion (MATE) transporter potently, it also inhibits dihydrofolate reductase (DHFR), used for protozoal infections and interferes with tetrahydrofolic acid synthesis from folic acid.
| Trivial name | Pirimecidan; Pirimetamin; RP 4753 |
| Catalog Number | CSN12806 |
| Alternative Name(s) | Pirimecidan; Pirimetamin; RP 4753 |
| Research Area | / |
| Molecular Formula | C12H13ClN4 |
| CAS# | 58-14-0 |
| Purity | ≥99% |
| SMILES | NC1=NC(CC)=C(C2=CC=C(Cl)C=C2)C(N)=N1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/pyrimethamine.html |
