Notoginsenoside R1
Notoginsenoside R1, the main bioactive component isolated and purified from the roots of Panax notoginseng (Burk.)F.H.Chen, is reported to have some neuronal protective, antihypertensive effects.
| Trivial name | Sanchinoside R1; Sanqi Glucoside R1 |
| Catalog Number | CSN12776 |
| Alternative Name(s) | Sanchinoside R1; Sanqi Glucoside R1 |
| Research Area | / |
| Molecular Formula | C47H80O18 |
| CAS# | 80418-24-2 |
| Purity | ≥98% |
| SMILES | C[C@]([C@@](C[C@H]1O)([H])[C@@]2(C)CC[C@@H]3O)(C[C@@H]([C@]2(C3(C)C)[H])O[C@@](O[C@@H]([C@H]([C@@H]4O)O)CO)([H])[C@@H]4O[C@@](OC[C@H]([C@@H]5O)O)([H])[C@@H]5O)[C@@]6(C)[C@]1([C@]([C@@](CC/C=C(C)/C)(C)O[C@H](O[C@@H]7CO)[C@H](O)[C@H]([C@@H]7O)O)([H])CC6)[H] |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/notoginsenoside-r1.html |
