Eflornithine HCl H2O
Eflornithine HCl is a specific, irreversible inhibitor of the enzyme ornithine decarboxylase, is a medication for the treatment of African trypanosomiasis and excessive facial hair growth in women.
| Trivial name | Difluoromethylornithine HCl Hydrate; DFMO HCl Hydrate; MDL 71782 HCl Hydrate; RMI-71782 HCl Hydrate |
| Catalog Number | CSN12752 |
| Alternative Name(s) | Difluoromethylornithine HCl Hydrate; DFMO HCl Hydrate; MDL 71782 HCl Hydrate; RMI-71782 HCl Hydrate |
| Research Area | / |
| Molecular Formula | C6H15ClF2N2O3 |
| CAS# | 96020-91-6 |
| Purity | ≥98% |
| SMILES | O=C(O)C(C(F)F)(N)CCCN.[H]Cl.[H]O[H] |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/eflornithine-hcl-h2o.html |
