Calcium N5-methyltetrahydrofolate
Calcium N5-methyltetrahydrofolate is the calcium salt of levomefolic acid, which has been proposed for treatment of cardiovascular disease and advanced cancers such as breast and colorectal cancers.
| Trivial name | NSC 173328 |
| Catalog Number | CSN12746 |
| Alternative Name(s) | NSC 173328 |
| Research Area | Cancer |
| Molecular Formula | C20H23CaN7O6 |
| CAS# | 26560-38-3 |
| Purity | ≥95% |
| SMILES | O=C([O-])[C@@H](NC(C1=CC=C(NCC2N(C)C3=C(N=C(N)NC3=O)NC2)C=C1)=O)CCC([O-])=O.[Ca+2] |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/calcium-n5-methyltetrahydrofolate.html |