Flufenamic Acid
Flufenamic Acid is a COX inhibitor and prevents formation of prostaglandins, binds to and reduce the activity of prostaglandin F synthase and activate TRPC6, it is a NSAID drug.
| Trivial name | / |
| Catalog Number | CSN12744 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C14H10F3NO2 |
| CAS# | 530-78-9 |
| Purity | ≥99% |
| SMILES | O=C(O)C1=CC=CC=C1NC2=CC=CC(C(F)(F)F)=C2 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/flufenamic-acid.html |