PD153035 HCl
PD153035 HCl is an reversible inhibitor of EGFR with Ki and IC50 of 5.2 pM and 29 pM.
| Trivial name | SU-5271 HCl; ZM-252868 HCl |
| Catalog Number | CSN12700 |
| Alternative Name(s) | SU-5271 HCl; ZM-252868 HCl |
| Research Area | Cancer |
| Molecular Formula | C16H15BrClN3O2 |
| CAS# | 183322-45-4 |
| Purity | ≥99% |
| SMILES | COC1=CC2=NC=NC(NC3=CC=CC(Br)=C3)=C2C=C1OC.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/pd153035-hcl.html |
