Decitabine
Decitabine is a potent inhibitor of DNA methyltransferase with IC50 of 438 nM and 4.38 nM in HL-60 and KG1a cells, respectively.
| Trivial name | Deoxycytidine; NSC-127716; DAC; 5-Aza-2'-Deoxycytidine |
| Catalog Number | CSN12608 |
| Alternative Name(s) | Deoxycytidine; NSC-127716; DAC; 5-Aza-2'-Deoxycytidine |
| Research Area | Cancer |
| Molecular Formula | C8H12N4O4 |
| CAS# | 2353-33-5 |
| Purity | ≥99% |
| SMILES | OC[C@@H]1[C@H](C[C@H](N2C(N=C(N=C2)N)=O)O1)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/decitabine.html |
