Oxaprozin
Oxaprozin is a COX inhibitor with IC50s of 2.2 μM and 36 μM for human platelet COX-1 and IL-1-stimulated human synovial cell COX-2, it’s a NSAID used to relieve the inflammation, swelling, stiffness, and joint pain associated with osteoarthritis and rheumatoid arthritis.
| Trivial name | WY 21743 |
| Catalog Number | CSN12602 |
| Alternative Name(s) | WY 21743 |
| Research Area | / |
| Molecular Formula | C18H15NO3 |
| CAS# | 21256-18-8 |
| Purity | ≥99% |
| SMILES | O=C(O)CCC1=NC(C2=CC=CC=C2)=C(C3=CC=CC=C3)O1 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/oxaprozin.html |