Rosiglitazone Maleate
Rosiglitazone maleate is the maleate form of rosiglitazone which is a high-affinity selective agonist of the peroxisome proliferator-activated receptor-γ (PPARγ) with Kd of 40 nM and it also acts as a modulator of TRP channels.
| Trivial name | BRL-49653; BRL 49653C |
| Catalog Number | CSN12570 |
| Alternative Name(s) | BRL-49653; BRL 49653C |
| Research Area | Metabolic Disease |
| Molecular Formula | C22H23N3O7S |
| CAS# | 155141-29-0 |
| Purity | ≥99% |
| SMILES | O=C(SC1CC2=CC=C(C=C2)OCCN(C3=NC=CC=C3)C)NC1=O.O=C(/C=C\C(O)=O)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/rosiglitazone-maleate.html |