Tiotropium Bromide
Tiotropium bromide is amAChR antagonist which acts through blocking the binding of the acetylcholine ligand and subsequent opening of the ligand-gated ion channel.
| Trivial name | Tiopropium; Ba 679 BR |
| Catalog Number | CSN12534 |
| Alternative Name(s) | Tiopropium; Ba 679 BR |
| Research Area | Neurological Disease |
| Molecular Formula | C19H22BrNO4S2 |
| CAS# | 136310-93-5 |
| Purity | ≥98% |
| SMILES | C[N+]1(C)[C@@]2([H])[C@@]3([H])O[C@@]3([H])[C@]1([H])C[C@H](OC(C(C4=CC=CS4)(O)C5=CC=CS5)=O)C2.[Br-] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/tiotropium-bromide.html |
