Pioglitazone HCl
Pioglitazone HCl is a selective agonist of PPARγ with EC50 of 0.93 μM which is used to treat diabetes.
| Trivial name | AD 4833; U-72107A |
| Catalog Number | CSN12489 |
| Alternative Name(s) | AD 4833; U-72107A |
| Research Area | Metabolic Disease |
| Molecular Formula | C19H21ClN2O3S |
| CAS# | 112529-15-4 |
| Purity | ≥99% |
| SMILES | O=C(N1)SC(CC2=CC=C(OCCC3=NC=C(CC)C=C3)C=C2)C1=O.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/pioglitazone-hcl.html |
