Econazole
Econazole is an imidazole-derived and broad-spectrum antimycotic agent with fungistatic properties, working by inhibiting biosynthesis of ergosterol, thereby damaging the fungal cell wall membrane and altering its permeability.
| Trivial name | (±)-Econazole |
| Catalog Number | CSN12439 |
| Alternative Name(s) | (±)-Econazole |
| Research Area | Infection |
| Molecular Formula | C18H15Cl3N2O |
| CAS# | 27220-47-9 |
| Purity | ≥99% |
| SMILES | ClC1=CC=C(C(OCC2=CC=C(Cl)C=C2)CN3C=CN=C3)C(Cl)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/econazole.html |
