ABT-737
ABT-737 is a BH3 mimetic inhibitor of Bcl-xL, Bcl-2 and Bcl-w with EC50 of 78.7 nM, 30.3 nM and 197.8 nM, respectively, showing no inhibition observed against Mcl-1, Bcl-B or Bfl-1.
| Trivial name | / |
| Catalog Number | CSN12426 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C42H45ClN6O5S2 |
| CAS# | 852808-04-9 |
| Purity | ≥98% |
| SMILES | CN(CC[C@@H](NC1=CC=C(C=C1[N+]([O-])=O)S(NC(C2=CC=C(C=C2)N3CCN(CC3)CC4=CC=CC=C4C5=CC=C(C=C5)Cl)=O)(=O)=O)CSC6=CC=CC=C6)C |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/abt-737.html |