4′,7-Dimethoxyisoflavone
4′,7-Dimethoxyisoflavone is a kind of isoflavonoids with antifungal activity against some plant pathogenic fungi tested in vitro. It also showed inhibitory effects on rat prostate testosterone 5alpha-reductase.
| Trivial name | / |
| Catalog Number | CSN12400 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C17H14O4 |
| CAS# | 1157-39-7 |
| Purity | ≥98% |
| SMILES | O=C1C(C2=CC=C(OC)C=C2)=COC3=C1C=CC(OC)=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/4',7-dimethoxyisoflavone.html |
