Glycitein
Glycitein, a soybean isoflavonoid with anti-oxidation, can induce the expression of antioxidant genes like antioxidant response element (ARE). It is also used in the study of apoptosis when combination with other isoflavonoids such as genistein and daidzein.
| Trivial name | / |
| Catalog Number | CSN12353 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C16H12O5 |
| CAS# | 40957-83-3 |
| Purity | ≥98% |
| SMILES | O=C1C(C2=CC=C(O)C=C2)=COC3=C1C=C(OC)C(O)=C3 |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/glycitein.html |