Acacetin
Acacetin shows inhibiton of the proliferation and induction apoptosis for cancer cells. It is a flavonoid purified from the bark of acacia farnesiana with anti-peroxidant, antiarthritic, and anti-inflammatory activities,
| Trivial name | Linarigenin; 5,7-dihydroxy-4'-methoxyflavone; 4'-Methoxyapigenin |
| Catalog Number | CSN12350 |
| Alternative Name(s) | Linarigenin; 5,7-dihydroxy-4'-methoxyflavone; 4'-Methoxyapigenin |
| Research Area | / |
| Molecular Formula | C16H12O5 |
| CAS# | 480-44-4 |
| Purity | ≥99% |
| SMILES | O=C1C=C(C2=CC=C(OC)C=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/acacetin.html |
