Oxyresveratrol
Oxyresveratrol is a naturallly occuring stilbenoid found in the heartwood of Artocarpus lakoocha, which works as a potent tyrosinase inhibitor and also possesses anti-proliferative, anti-inflammatory, and cardioprotective properties.
| Trivial name | Tetrahydroxystilbene; 2,3',4,5'-tetrahydroxystilbene |
| Catalog Number | CSN12329 |
| Alternative Name(s) | Tetrahydroxystilbene; 2,3',4,5'-tetrahydroxystilbene |
| Research Area | / |
| Molecular Formula | C14H12O4 |
| CAS# | 29700-22-9 |
| Purity | ≥99% |
| SMILES | OC1=CC=C(/C=C/C2=CC(O)=CC(O)=C2)C(O)=C1 |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/oxyresveratrol.html |