Pneumocandin B0
Pneumocandin B0 is used to synthesize caspofungin. It is a strong antifungal working by inhibiting the synthesis of β-(1→3)-D-glucan, which is a fundamental component in most cell walls
Trivial name | L 688786 |
Catalog Number | CSN12279 |
Alternative Name(s) | L 688786 |
Research Area | Infection |
Molecular Formula | C50H80N8O17 |
CAS# | 135575-42-7 |
Purity | ≥98% |
SMILES | O=C(N1[C@@]([H])([C@H](CC1)O)C(N[C@H](O)[C@H](O)C[C@H](NC(CCCCCCCC[C@H](C[C@H](CC)C)C)=O)C(NC2[C@@H](C)O)=O)=O)[C@]([H])([C@@H](CC(N)=O)O)NC(C([C@@H]([C@@H](O)C3=CC=C(C=C3)O)O)NC([C@]4([H])C[C@H](CN4C2=O)O)=O)=O |
Size | 5mg |
Supplier Page | https://www.csnpharm.com/products/pneumocandin-b0.html |