Galangin
Galangin functions as an antagonist of the aryl hydrocarbon receptor and also inhibits CYP1A1 (IC50 = 1 μM). It belongs to flavonoids and can be extracted from the rhizome of Zingiber officinale Roscoe with anti-inflammatory properties.
| Trivial name | Norizalpinin |
| Catalog Number | CSN12256 |
| Alternative Name(s) | Norizalpinin |
| Research Area | Cancer |
| Molecular Formula | C15H10O5 |
| CAS# | 548-83-4 |
| Purity | ≥99% |
| SMILES | O=C1C(O)=C(C2=CC=CC=C2)OC3=C1C(O)=CC(O)=C3 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/galangin.html |
