DTNB
DTNB is a chemical used to quantify the number or concentration of thiol groups in a sample and can be used for measuring low-molecular mass thiols such as glutathione in both pure solutions and biological samples, such as blood.
| Trivial name | Ellman's Reagent |
| Catalog Number | CSN12232 |
| Alternative Name(s) | Ellman's Reagent |
| Research Area | / |
| Molecular Formula | C14H8N2O8S2 |
| CAS# | 69-78-3 |
| Purity | ≥99% |
| SMILES | O=C(O)C1=CC(SSC2=CC=C([N+]([O-])=O)C(C(O)=O)=C2)=CC=C1[N+]([O-])=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/dtnb.html |