Tubeimoside I
Tubeimoside I is a naturally occuring triterpenoid saponin isolated from the medicinal herb B. paniculatum, with anti-inflammatory, apoptotic and antitumor activity.
| Trivial name | Tubeimoside-1; Lobatoside H |
| Catalog Number | CSN12158 |
| Alternative Name(s) | Tubeimoside-1; Lobatoside H |
| Research Area | Cancer |
| Molecular Formula | C63H98O29 |
| CAS# | 102040-03-9 |
| Purity | ≥99% |
| SMILES | O[C@@H](CO1)[C@H](O)[C@@H](OC(C[C@](CC(OC2)=O)(O)C)=O)[C@@H]1O[C@H]([C@@H](O)[C@@H]([C@H]3CO)O)[C@@H](O3)O[C@@H]([C@H]4O)[C@]2(C)[C@@](CC5)([H])[C@@](C4)(C)[C@]6([H])[C@]5(C)[C@@]7(C)C([C@@](CC(C)(CC8)C)([H])[C@@]8(C(O[C@H]9[C@@H]([C@@H](O)[C@H](CO9)O)O[C@H](O%10)[C@H](O)[C@@H]([C@H]([C@@H]%10C)O)O[C@H]%11[C@H](O)[C@@H](O)[C@@H](CO%11)O)=O)CC7)=CC6 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tubeimoside-i.html |
