Topiramate
Topiramate is a selective GluK1 kainate receptors (GluR5) antagonist with IC50 value of 0.46 μM which can act as a positive allosteric modulator of GABAA receptor-mediated currents, inhibit Nav channels and L-type Ca2+ channels.
| Trivial name | MCN 4853; RWJ-17021 |
| Catalog Number | CSN12115 |
| Alternative Name(s) | MCN 4853; RWJ-17021 |
| Research Area | Neurological Disease |
| Molecular Formula | C12H21NO8S |
| CAS# | 97240-79-4 |
| Purity | ≥98% |
| SMILES | CC1(O[C@H]([C@@H](CO[C@@]2(COS(=O)(N)=O)O3)O1)[C@@H]2OC3(C)C)C |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/topiramate.html |