Tizanidine HCl
Tiamenidine HCl is a centrally-acting α1 and α2 adrenergic receptor antagonist with IC50 4.85 μM and 0.0091 μM, respectively, for the management of essential hypertension.
| Trivial name | DS 103-282 |
| Catalog Number | CSN12099 |
| Alternative Name(s) | DS 103-282 |
| Research Area | Neurological Disease |
| Molecular Formula | C9H9Cl2N5S |
| CAS# | 64461-82-1 |
| Purity | ≥99% |
| SMILES | ClC1=C(NC2=NCCN2)C3=NSN=C3C=C1.Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tizanidine-hcl.html |