7ACC1
7ACC1 selectively interfere with lactate fluxes in the lactate-rich tumor microenvironment and inhibits lactate influx but not efflux in tumor cells expressing MCT1 and MCT4 transporters.
| Trivial name | DEAC; Coumarin-D1421; D-1421 |
| Catalog Number | CSN12098 |
| Alternative Name(s) | DEAC; Coumarin-D1421; D-1421 |
| Research Area | Cancer |
| Molecular Formula | C14H15NO4 |
| CAS# | 50995-74-9 |
| Purity | ≥99% |
| SMILES | O=C(C(C1=O)=CC2=C(O1)C=C(N(CC)CC)C=C2)O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/7acc1.html |