Suplatast Tosylate
Suplatast Tosylate is an inhibitor of Th2 cytokine synthesis which can attenuate IL-2, IL-5 and IL-13 production and has no effect on IFN-γ production.
| Trivial name | IPD-1151T |
| Catalog Number | CSN12018 |
| Alternative Name(s) | IPD-1151T |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C23H33NO7S2 |
| CAS# | 94055-76-2 |
| Purity | ≥99% |
| SMILES | C[S+](CCC(NC1=CC=C(OCC(O)COCC)C=C1)=O)C.O=S(C2=CC=C(C)C=C2)([O-])=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/suplatast-tosylate.html |