Sulfadimethoxine
Sulfadimethoxine is a sulfonamide antibiotic used to treat many infections including treatment of respiratory, urinary tract, enteric, and soft tissue infections and most frequently used in veterinary medicine.
| Trivial name | / |
| Catalog Number | CSN12002 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C12H14N4O4S |
| CAS# | 122-11-2 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=C(N)C=C1)(NC2=NC(OC)=NC(OC)=C2)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/sulfadimethoxine.html |
