Rotundine
Rotundine is antagonist for domapmine D1 receptor(Ki = 124 nM) and has a lower binding activity of domapmine D2 receptor and domapmine D3 receptor. It can also inhibit 5-HT1A (Ki = 340 nM).
| Trivial name | / |
| Catalog Number | CSN11868 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C21H25NO4 |
| CAS# | 483-14-7 |
| Purity | ≥99% |
| SMILES | COC1=CC=C2C(CN3CCC4=CC(OC)=C(OC)C=C4[C@]3([H])C2)=C1OC |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/rotundine.html |