Rifabutin
Rifabutin is an antibiotic used to treat tuberculosis and prevent and treat Mycobacterium avium complex, which works through inhibiting DNA-dependent RNA polymerase activity in susceptible cells.
| Trivial name | LM427; Ansamycin |
| Catalog Number | CSN11843 |
| Alternative Name(s) | LM427; Ansamycin |
| Research Area | Infection |
| Molecular Formula | C46H62N4O11 |
| CAS# | 72559-06-9 |
| Purity | ≥98% |
| SMILES | C[C@@]1(O2)O/C=C/[C@@H]([C@H]([C@H]([C@H](C)[C@H](O)[C@H](C)[C@H]([C@H](/C=C/C=C(C(NC(C3=O)=C4NC5(CCN(CC(C)C)CC5)N=C4C6=C3C(O)=C(C)C2=C6C1=O)=O)\C)C)O)OC(C)=O)C)OC |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/rifabutin.html |