Mepacrine 2HCl
Mepacrine 2HCl is an acridine-derived yellow dye, previously used in the therapy and prevention of malaria and later as an antiprotozoal and immunomodulatory agent. It’s also an inhibitor of phospholipase A2.
| Trivial name | Quinacrine 2HCl; SN-390 |
| Catalog Number | CSN11815 |
| Alternative Name(s) | Quinacrine 2HCl; SN-390 |
| Research Area | Cancer |
| Molecular Formula | C23H32Cl3N3O |
| CAS# | 69-05-6 |
| Purity | ≥99% |
| SMILES | CC(NC1=C(C=C(OC)C=C2)C2=NC3=CC(Cl)=CC=C31)CCCN(CC)CC.Cl.Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/mepacrine-2hcl.html |
