Procarbazine HCl
Procarbazine HCl, an antineoplastic chemotherapy drug, is an alkylating agent for the treatment of Hodgkin’s lymphoma and certain brain cancers and also inhibits MAO thus increasing the effects of sympathomimetics, TCAs, and tyramine.
| Trivial name | NSC 77213 HCl |
| Catalog Number | CSN11776 |
| Alternative Name(s) | NSC 77213 HCl |
| Research Area | Cancer |
| Molecular Formula | C12H20ClN3O |
| CAS# | 366-70-1 |
| Purity | ≥98% |
| SMILES | O=C(NC(C)C)C1=CC=C(CNNC)C=C1.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/procarbazine-hcl.html |