Pramipexole 2HCl
Pramipexole 2HCl is an dopamine agonist and can inhibit multiple dopamine receptors including dopamine D2S receptor, dopamine D2L receptor, dopamine D3 receptor, and dopamine D4 receptor with respectively Ki values of 3.9, 2.2, 0.5 and 5.1 nM.
| Trivial name | SND 919 2HCl |
| Catalog Number | CSN11760 |
| Alternative Name(s) | SND 919 2HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C10H19Cl2N3S |
| CAS# | 104632-25-9 |
| Purity | ≥99% |
| SMILES | NC1=NC2=C(C[C@@H](NCCC)CC2)S1.[H]Cl.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/pramipexole-2hcl.html |