Glycitin
Glycitin, a natural isoflavone, could promote the proliferation of bone marrow stromal cells and osteoblasts and protect the loss of bone. It can be isolated and purified from legumes.
| Trivial name | Glycitein 7-O-β-glucoside |
| Catalog Number | CSN11706 |
| Alternative Name(s) | Glycitein 7-O-β-glucoside |
| Research Area | / |
| Molecular Formula | C22H22O10 |
| CAS# | 40246-10-4 |
| Purity | ≥99% |
| SMILES | O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](OC2=CC(OC=C(C3=CC=C(O)C=C3)C4=O)=C4C=C2OC)[C@@H]1O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/glycitin.html |