Mitotane
Mitotane is a steroidogenesis inhibitor and cytostatic antineoplastic medication which is used in the treatment of adrenocortical carcinoma and Cushing’s syndrome.
| Trivial name | NCI-C04933; NCI C-049332; 4′-DDD; O,p'-DDD |
| Catalog Number | CSN11593 |
| Alternative Name(s) | NCI-C04933; NCI C-049332; 4′-DDD; O,p'-DDD |
| Research Area | Cancer |
| Molecular Formula | C14H10Cl4 |
| CAS# | 53-19-0 |
| Purity | ≥99% |
| SMILES | ClC1=CC=C(C(C2=CC=CC=C2Cl)C(Cl)Cl)C=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/mitotane.html |