Milrinone
Milrinone is a phosphodiesterase 3 (PDE3) inhibitor with IC50 of 56 nM, it increases intracellular cyclic adenosine monophosphate resulting in improved ventricular function and vasodilation.
| Trivial name | Win 47203 |
| Catalog Number | CSN11549 |
| Alternative Name(s) | Win 47203 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C12H9N3O |
| CAS# | 78415-72-2 |
| Purity | ≥99% |
| SMILES | N#CC1=CC(C2=CC=NC=C2)=C(C)NC1=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/milrinone.html |