Natamycin
Natamycin is a naturally occuring polyene macrolide antibiotic and antifungal medication used to treat fungal infections around the eye and in the food industry for the surface treatment of cheese and sausages.
| Trivial name | Pimaricin |
| Catalog Number | CSN11525 |
| Alternative Name(s) | Pimaricin |
| Research Area | Infection |
| Molecular Formula | C33H47NO13 |
| CAS# | 7681-93-8 |
| Purity | ≥99% |
| SMILES | OC([C@H]1[C@@](C[C@H](/C=C/C=C/C=C/C=C/C[C@@H](C)OC2=O)O[C@@](O[C@H](C)[C@@H](O)[C@@H]3N)([H])[C@H]3O)([H])O[C@](O)(C[C@H](C[C@]4([H])[C@@H](/C=C/2)O4)O)C[C@@H]1O)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/natamycin.html |
