Arbutin
Arbutin is an inhibitor of tyrosinase with IC50 of 1.09 mM and can prevent the formation of melanin. It is a glycosylated hydroquinone found in the leaves of arctostaphylos uvaursi.
| Trivial name | Uva; P-Arbutin; β-Arbutin; beta-Arbutin |
| Catalog Number | CSN11495 |
| Alternative Name(s) | Uva; P-Arbutin; β-Arbutin; beta-Arbutin |
| Research Area | / |
| Molecular Formula | C12H16O7 |
| CAS# | 497-76-7 |
| Purity | ≥99% |
| SMILES | OC1=CC=C(O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O2)C=C1 |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/arbutin.html |