Moroxydine HCl
Moroxydine HCl is an antiviral drug used to treat influenza, active against RNA and DNA viruses. It is also an inhibitor of PTP1B and TCPTP inhibitor with IC50 values of 80-160 nM.
| Trivial name | ABOB HCl |
| Catalog Number | CSN11470 |
| Alternative Name(s) | ABOB HCl |
| Research Area | Infection |
| Molecular Formula | C6H14ClN5O |
| CAS# | 3160-91-6 |
| Purity | ≥98% |
| SMILES | N=C(N1CCOCC1)NC(N)=N.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/moroxydine-hcl.html |