Mizoribine
Mizoribine is an immunosuppressive agents (IC50=100 μM) that inhibit the proliferation of lymphocytes selectively, via inhibition of IMPDH.
| Trivial name | NSC 289637; β-Bredinin; beta-Bredinin; HE-69 |
| Catalog Number | CSN11454 |
| Alternative Name(s) | NSC 289637; β-Bredinin; beta-Bredinin; HE-69 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C9H13N3O6 |
| CAS# | 50924-49-7 |
| Purity | ≥99% |
| SMILES | O=C(C1=C(O)N([C@H]2[C@@H]([C@@H]([C@@H](CO)O2)O)O)C=N1)N |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/mizoribine.html |
