Dansyl Chloride
Dansyl chloride is a strong fluorescent agent that can be used to determine the amino terminus of a peptide chain. It can specifically react with the chain N-terminal α-amino group.
| Trivial name | DNSCl |
| Catalog Number | CSN11407 |
| Alternative Name(s) | DNSCl |
| Research Area | / |
| Molecular Formula | C12H12ClNO2S |
| CAS# | 605-65-2 |
| Purity | ≥98% |
| SMILES | O=S(C1=C2C=CC=C(N(C)C)C2=CC=C1)(Cl)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/dansyl-chloride.html |
