Aloin A
Aloin A, an anthracycline from aloe plants, can be used as a chemopreventive factor with antineoplastic activity. It exhibits inhibition of phosphodiesterase and tyrosinase.
| Trivial name | Barbalin; Barbaloin; Aloin; Barbaloin-A |
| Catalog Number | CSN11403 |
| Alternative Name(s) | Barbalin; Barbaloin; Aloin; Barbaloin-A |
| Research Area | Cancer |
| Molecular Formula | C21H22O9 |
| CAS# | 1415-73-2 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(C=CC=C2O)[C@H]([C@H]3[C@@H]([C@H]([C@@H]([C@@H](CO)O3)O)O)O)C4=CC(CO)=CC(O)=C14 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/aloin-a.html |
