Methazolamide
Methazolamide is a carbonic anhydrase inhibitor with Ki of 50 nM, 14 nM and 36 nM for hCA I, hCA II and bCA IV isoforms, respectively.
| Trivial name | CL 8490; L-584601 |
| Catalog Number | CSN11393 |
| Alternative Name(s) | CL 8490; L-584601 |
| Research Area | / |
| Molecular Formula | C5H8N4O3S2 |
| CAS# | 554-57-4 |
| Purity | ≥99% |
| SMILES | CC(/N=C1SC(S(N)(=O)=O)=NN/1C)=O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/methazolamide.html |
