Lornoxicam
Lornoxicam is a COX inhibitor with IC50 of 5 nM and 8 nM for COX1 and 2 respectively. It’s a non-steroidal anti-inflammatory drug (NSAID) used in the treatment of various types of pain.
| Trivial name | Chlortenoxicam; Ro139297; TS-110 |
| Catalog Number | CSN11332 |
| Alternative Name(s) | Chlortenoxicam; Ro139297; TS-110 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C13H10ClN3O4S2 |
| CAS# | 70374-39-9 |
| Purity | ≥95% |
| SMILES | O=C(C1=C(O)C2=C(C=C(Cl)S2)S(N1C)(=O)=O)NC3=NC=CC=C3 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/lornoxicam.html |
